C20H28O5 — CID 102112610
dimethyl 2-(5,5-dimethylhexa-2,3-dienyl)-2-(7-oxohept-2-ynyl)propanedioate (PubChem CID 102112610) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is dimethyl 2-(5,5-dimethylhexa-2,3-dienyl)-2-(7-oxohept-2-ynyl)propanedioate.
| Compound Name | dimethyl 2-(5,5-dimethylhexa-2,3-dienyl)-2-(7-oxohept-2-ynyl)propanedioate |
|---|---|
| PubChem CID | 102112610 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | dimethyl 2-(5,5-dimethylhexa-2,3-dienyl)-2-(7-oxohept-2-ynyl)propanedioate |
| SMILES | COC(=O)C(CC#CCCCC=O)(CC=C=CC(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C20H28O5/c1-19(2,3)13-10-11-15-20(17(22)24-4,18(23)25-5)14-9-7-6-8-12-16-21/h11,13,16H,6,8,12,14-15H2,1-5H3 |
| InChIKey | UPSORHXETYKJTP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|