C13H13BFNO4 — CID 102112643
2-[1-(4-fluorophenyl)ethenyl]-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione (PubChem CID 102112643) has the molecular formula C13H13BFNO4 and a molecular weight of 277.06 g/mol. Its IUPAC name is 2-[1-(4-fluorophenyl)ethenyl]-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione.
| Compound Name | 2-[1-(4-fluorophenyl)ethenyl]-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione |
|---|---|
| PubChem CID | 102112643 |
| Molecular Formula | C13H13BFNO4 |
| Molecular Weight | 277.06 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 2-[1-(4-fluorophenyl)ethenyl]-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione |
| SMILES | C=C(B1OC(=O)CN(C)CC(=O)O1)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H13BFNO4/c1-9(10-3-5-11(15)6-4-10)14-19-12(17)7-16(2)8-13(18)20-14/h3-6H,1,7-8H2,2H3 |
| InChIKey | ZCYIMNDWJCCAAV-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.06 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|