C23H15F9 — CID 102112732
1,6,7,10-tetramethyl-3,8,9-tris(trifluoromethyl)fluoranthene (PubChem CID 102112732) has the molecular formula C23H15F9 and a molecular weight of 462.36 g/mol. Its IUPAC name is 1,6,7,10-tetramethyl-3,8,9-tris(trifluoromethyl)fluoranthene.
| Compound Name | 1,6,7,10-tetramethyl-3,8,9-tris(trifluoromethyl)fluoranthene |
|---|---|
| PubChem CID | 102112732 |
| Molecular Formula | C23H15F9 |
| Molecular Weight | 462.36 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | 1,6,7,10-tetramethyl-3,8,9-tris(trifluoromethyl)fluoranthene |
| SMILES | Cc1ccc2c(C(F)(F)F)cc(C)c3c2c1-c1c(C)c(C(F)(F)F)c(C(F)(F)F)c(C)c1-3 |
| InChI | InChI=1S/C23H15F9/c1-8-5-6-12-13(21(24,25)26)7-9(2)15-17-11(4)20(23(30,31)32)19(22(27,28)29)10(3)16(17)14(8)18(12)15/h5-7H,1-4H3 |
| InChIKey | VITTZXJDNQEQAA-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.36 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |