C21H30O — CID 102112844
(2S,4aR,9aR)-1,1,4a,7-tetramethyl-6-phenyl-3,4,5,8,9,9a-hexahydro-2H-benzo[7]annulen-2-ol (PubChem CID 102112844) has the molecular formula C21H30O and a molecular weight of 298.47 g/mol. Its IUPAC name is (2S,4aR,9aR)-1,1,4a,7-tetramethyl-6-phenyl-3,4,5,8,9,9a-hexahydro-2H-benzo[7]annulen-2-ol.
| Compound Name | (2S,4aR,9aR)-1,1,4a,7-tetramethyl-6-phenyl-3,4,5,8,9,9a-hexahydro-2H-benzo[7]annulen-2-ol |
|---|---|
| PubChem CID | 102112844 |
| Molecular Formula | C21H30O |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | (2S,4aR,9aR)-1,1,4a,7-tetramethyl-6-phenyl-3,4,5,8,9,9a-hexahydro-2H-benzo[7]annulen-2-ol |
| SMILES | CC1=C(c2ccccc2)C[C@@]2(C)CC[C@H](O)C(C)(C)[C@@H]2CC1 |
| InChI | InChI=1S/C21H30O/c1-15-10-11-18-20(2,3)19(22)12-13-21(18,4)14-17(15)16-8-6-5-7-9-16/h5-9,18-19,22H,10-14H2,1-4H3/t18-,19-,21+/m0/s1 |
| InChIKey | MGVCTVRUWAHFTM-IRFCIJBXSA-N |
| XLogP | 5.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |