C16H12F3N3O2S — CID 102112884
1-(4-methylphenyl)sulfonyl-5-[4-(trifluoromethyl)phenyl]triazole (PubChem CID 102112884) has the molecular formula C16H12F3N3O2S and a molecular weight of 367.35 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-5-[4-(trifluoromethyl)phenyl]triazole.
| Compound Name | 1-(4-methylphenyl)sulfonyl-5-[4-(trifluoromethyl)phenyl]triazole |
|---|---|
| PubChem CID | 102112884 |
| Molecular Formula | C16H12F3N3O2S |
| Molecular Weight | 367.35 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-5-[4-(trifluoromethyl)phenyl]triazole |
| SMILES | Cc1ccc(S(=O)(=O)n2nncc2-c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C16H12F3N3O2S/c1-11-2-8-14(9-3-11)25(23,24)22-15(10-20-21-22)12-4-6-13(7-5-12)16(17,18)19/h2-10H,1H3 |
| InChIKey | MXBMDUFVCDODNZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.35 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |