C25H34N2O4 — CID 102113031
tert-butyl (1R,9R,12R)-12-ethenyl-13-(2-hydroxyethyl)-4-methoxy-8,13-diazapentacyclo[10.3.2.01,9.02,7.09,16]heptadeca-2(7),3,5-triene-8-carboxylate (PubChem CID 102113031) has the molecular formula C25H34N2O4 and a molecular weight of 426.56 g/mol. Its IUPAC name is tert-butyl (1R,9R,12R)-12-ethenyl-13-(2-hydroxyethyl)-4-methoxy-8,13-diazapentacyclo[10.3.2.01,9.02,7.09,16]heptadeca-2(7),3,5-triene-8-carboxylate.
| Compound Name | tert-butyl (1R,9R,12R)-12-ethenyl-13-(2-hydroxyethyl)-4-methoxy-8,13-diazapentacyclo[10.3.2.01,9.02,7.09,16]heptadeca-2(7),3,5-triene-8-carboxylate |
|---|---|
| PubChem CID | 102113031 |
| Molecular Formula | C25H34N2O4 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | tert-butyl (1R,9R,12R)-12-ethenyl-13-(2-hydroxyethyl)-4-methoxy-8,13-diazapentacyclo[10.3.2.01,9.02,7.09,16]heptadeca-2(7),3,5-triene-8-carboxylate |
| SMILES | C=C[C@@]12CC[C@@]34C(C1)[C@]3(CCN2CCO)c1cc(OC)ccc1N4C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H34N2O4/c1-6-23-9-10-25-20(16-23)24(25,11-12-26(23)13-14-28)18-15-17(30-5)7-8-19(18)27(25)21(29)31-22(2,3)4/h6-8,15,20,28H,1,9-14,16H2,2-5H3/t20?,23-,24+,25-/m1/s1 |
| InChIKey | ZQSCCTBPABXRLK-IQNLPGKKSA-N |
| XLogP | 3.86 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|