C26H40O8 — CID 102113481
4-O,5-O-ditert-butyl 2-O,2-O'-diethyl 7-methylidene-3,3a,4,5,6,7a-hexahydro-1H-indene-2,2,4,5-tetracarboxylate (PubChem CID 102113481) has the molecular formula C26H40O8 and a molecular weight of 480.60 g/mol. Its IUPAC name is 4-O,5-O-ditert-butyl 2-O,2-O'-diethyl 7-methylidene-3,3a,4,5,6,7a-hexahydro-1H-indene-2,2,4,5-tetracarboxylate.
| Compound Name | 4-O,5-O-ditert-butyl 2-O,2-O'-diethyl 7-methylidene-3,3a,4,5,6,7a-hexahydro-1H-indene-2,2,4,5-tetracarboxylate |
|---|---|
| PubChem CID | 102113481 |
| Molecular Formula | C26H40O8 |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | 4-O,5-O-ditert-butyl 2-O,2-O'-diethyl 7-methylidene-3,3a,4,5,6,7a-hexahydro-1H-indene-2,2,4,5-tetracarboxylate |
| SMILES | C=C1CC(C(=O)OC(C)(C)C)C(C(=O)OC(C)(C)C)C2CC(C(=O)OCC)(C(=O)OCC)CC12 |
| InChI | InChI=1S/C26H40O8/c1-10-31-22(29)26(23(30)32-11-2)13-17-15(3)12-16(20(27)33-24(4,5)6)19(18(17)14-26)21(28)34-25(7,8)9/h16-19H,3,10-14H2,1-2,4-9H3 |
| InChIKey | WKKWFTRODUEMME-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|