C21H32O6 — CID 102113486
5-O-tert-butyl 2-O,2-O'-diethyl 7-methylidene-3,3a,4,5,6,7a-hexahydro-1H-indene-2,2,5-tricarboxylate (PubChem CID 102113486) has the molecular formula C21H32O6 and a molecular weight of 380.48 g/mol. Its IUPAC name is 5-O-tert-butyl 2-O,2-O'-diethyl 7-methylidene-3,3a,4,5,6,7a-hexahydro-1H-indene-2,2,5-tricarboxylate.
| Compound Name | 5-O-tert-butyl 2-O,2-O'-diethyl 7-methylidene-3,3a,4,5,6,7a-hexahydro-1H-indene-2,2,5-tricarboxylate |
|---|---|
| PubChem CID | 102113486 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 5-O-tert-butyl 2-O,2-O'-diethyl 7-methylidene-3,3a,4,5,6,7a-hexahydro-1H-indene-2,2,5-tricarboxylate |
| SMILES | C=C1CC(C(=O)OC(C)(C)C)CC2CC(C(=O)OCC)(C(=O)OCC)CC12 |
| InChI | InChI=1S/C21H32O6/c1-7-25-18(23)21(19(24)26-8-2)11-15-10-14(9-13(3)16(15)12-21)17(22)27-20(4,5)6/h14-16H,3,7-12H2,1-2,4-6H3 |
| InChIKey | REBJAJJKIIVGSD-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|