About (5S)-3,5-bis(4-chlorophenyl)-5-ethyl-4H-1,2-oxazole
(5S)-3,5-bis(4-chlorophenyl)-5-ethyl-4H-1,2-oxazole (PubChem CID 102113523) has the molecular formula C17H15Cl2NO
and a molecular weight of 320.22 g/mol. Its IUPAC name is (5S)-3,5-bis(4-chlorophenyl)-5-ethyl-4H-1,2-oxazole.
Molecular Properties
| Compound Name | (5S)-3,5-bis(4-chlorophenyl)-5-ethyl-4H-1,2-oxazole |
| PubChem CID | 102113523 |
| Molecular Formula | C17H15Cl2NO |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | (5S)-3,5-bis(4-chlorophenyl)-5-ethyl-4H-1,2-oxazole |
| SMILES | CC[C@@]1(c2ccc(Cl)cc2)CC(c2ccc(Cl)cc2)=NO1 |
| InChI | InChI=1S/C17H15Cl2NO/c1-2-17(13-5-9-15(19)10-6-13)11-16(20-21-17)12-3-7-14(18)8-4-12/h3-10H,2,11H2,1H3/t17-/m0/s1 |
| InChIKey | YPZIMDPPNKUZAR-KRWDZBQOSA-N |
| XLogP | 5.42 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5S)-3,5-bis(4-chlorophenyl)-5-ethyl-4H-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-3,5-bis(4-chlorophenyl)-5-ethyl-4H-1,2-oxazole?
The IUPAC name of (5S)-3,5-bis(4-chlorophenyl)-5-ethyl-4H-1,2-oxazole (CID 102113523) is (5S)-3,5-bis(4-chlorophenyl)-5-ethyl-4H-1,2-oxazole.
What is the SMILES notation for (5S)-3,5-bis(4-chlorophenyl)-5-ethyl-4H-1,2-oxazole?
The canonical SMILES for (5S)-3,5-bis(4-chlorophenyl)-5-ethyl-4H-1,2-oxazole is CC[C@@]1(c2ccc(Cl)cc2)CC(c2ccc(Cl)cc2)=NO1.
What is the InChIKey of (5S)-3,5-bis(4-chlorophenyl)-5-ethyl-4H-1,2-oxazole?
The InChIKey is YPZIMDPPNKUZAR-KRWDZBQOSA-N. The full InChI is InChI=1S/C17H15Cl2NO/c1-2-17(13-5-9-15(19)10-6-13)11-16(20-21-17)12-3-7-14(18)8-4-12/h3-10H,2,11H2,1H3/t17-/m0/s1.
What are the key properties of (5S)-3,5-bis(4-chlorophenyl)-5-ethyl-4H-1,2-oxazole?
(5S)-3,5-bis(4-chlorophenyl)-5-ethyl-4H-1,2-oxazole has a molecular weight of 320.22 g/mol, XLogP of 5.42, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-3,5-bis(4-chlorophenyl)-5-ethyl-4H-1,2-oxazole is sourced from PubChem (CID 102113523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).