C34H45F5O5 — CID 10211366
11-[7-hydroxy-3-(4-hydroxyphenyl)-3-propyl-2,4-dihydrochromen-4-yl]-2-(4,4,5,5,5-pentafluoropentyl)undecanoic acid (PubChem CID 10211366) has the molecular formula C34H45F5O5 and a molecular weight of 628.72 g/mol. Its IUPAC name is 11-[7-hydroxy-3-(4-hydroxyphenyl)-3-propyl-2,4-dihydrochromen-4-yl]-2-(4,4,5,5,5-pentafluoropentyl)undecanoic acid.
| Compound Name | 11-[7-hydroxy-3-(4-hydroxyphenyl)-3-propyl-2,4-dihydrochromen-4-yl]-2-(4,4,5,5,5-pentafluoropentyl)undecanoic acid |
|---|---|
| PubChem CID | 10211366 |
| Molecular Formula | C34H45F5O5 |
| Molecular Weight | 628.72 g/mol |
| Exact Mass | 628.32 |
| IUPAC Name | 11-[7-hydroxy-3-(4-hydroxyphenyl)-3-propyl-2,4-dihydrochromen-4-yl]-2-(4,4,5,5,5-pentafluoropentyl)undecanoic acid |
| SMILES | CCCC1(c2ccc(O)cc2)COc2cc(O)ccc2C1CCCCCCCCCC(CCCC(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C34H45F5O5/c1-2-20-32(25-14-16-26(40)17-15-25)23-44-30-22-27(41)18-19-28(30)29(32)13-9-7-5-3-4-6-8-11-24(31(42)43)12-10-21-33(35,36)34(37,38)39/h14-19,22,24,29,40-41H,2-13,20-21,23H2,1H3,(H,42,43) |
| InChIKey | JIABLGFIYHOZFU-UHFFFAOYSA-N |
| XLogP | 9.89 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.72 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|