About 1-benzyl-3'-methylidenespiro[indole-3,5'-oxolane]-2,2'-dione
1-benzyl-3'-methylidenespiro[indole-3,5'-oxolane]-2,2'-dione (PubChem CID 102113661) has the molecular formula C19H15NO3
and a molecular weight of 305.33 g/mol. Its IUPAC name is 1-benzyl-3'-methylidenespiro[indole-3,5'-oxolane]-2,2'-dione.
Molecular Properties
| Compound Name | 1-benzyl-3'-methylidenespiro[indole-3,5'-oxolane]-2,2'-dione |
| PubChem CID | 102113661 |
| Molecular Formula | C19H15NO3 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 1-benzyl-3'-methylidenespiro[indole-3,5'-oxolane]-2,2'-dione |
| SMILES | C=C1CC2(OC1=O)C(=O)N(Cc1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C19H15NO3/c1-13-11-19(23-17(13)21)15-9-5-6-10-16(15)20(18(19)22)12-14-7-3-2-4-8-14/h2-10H,1,11-12H2 |
| InChIKey | GPKUERAVBYIGTP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-3'-methylidenespiro[indole-3,5'-oxolane]-2,2'-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-3'-methylidenespiro[indole-3,5'-oxolane]-2,2'-dione?
The IUPAC name of 1-benzyl-3'-methylidenespiro[indole-3,5'-oxolane]-2,2'-dione (CID 102113661) is 1-benzyl-3'-methylidenespiro[indole-3,5'-oxolane]-2,2'-dione.
What is the SMILES notation for 1-benzyl-3'-methylidenespiro[indole-3,5'-oxolane]-2,2'-dione?
The canonical SMILES for 1-benzyl-3'-methylidenespiro[indole-3,5'-oxolane]-2,2'-dione is C=C1CC2(OC1=O)C(=O)N(Cc1ccccc1)c1ccccc12.
What is the InChIKey of 1-benzyl-3'-methylidenespiro[indole-3,5'-oxolane]-2,2'-dione?
The InChIKey is GPKUERAVBYIGTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15NO3/c1-13-11-19(23-17(13)21)15-9-5-6-10-16(15)20(18(19)22)12-14-7-3-2-4-8-14/h2-10H,1,11-12H2.
What are the key properties of 1-benzyl-3'-methylidenespiro[indole-3,5'-oxolane]-2,2'-dione?
1-benzyl-3'-methylidenespiro[indole-3,5'-oxolane]-2,2'-dione has a molecular weight of 305.33 g/mol, XLogP of 2.93, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-3'-methylidenespiro[indole-3,5'-oxolane]-2,2'-dione is sourced from PubChem (CID 102113661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).