C22H38Cl3NO6Si — CID 102113750
[(E)-3-[(4R,5R)-5-[(R)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl] 2,2,2-trichloroethanimidate (PubChem CID 102113750) has the molecular formula C22H38Cl3NO6Si and a molecular weight of 546.99 g/mol. Its IUPAC name is [(E)-3-[(4R,5R)-5-[(R)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl] 2,2,2-trichloroethanimidate.
| Compound Name | [(E)-3-[(4R,5R)-5-[(R)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 102113750 |
| Molecular Formula | C22H38Cl3NO6Si |
| Molecular Weight | 546.99 g/mol |
| Exact Mass | 545.15 |
| IUPAC Name | [(E)-3-[(4R,5R)-5-[(R)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC/C=C/[C@H]1OC(C)(C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1COC(C)(C)O1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C22H38Cl3NO6Si/c1-19(2,3)33(8,9)32-17(15-13-28-20(4,5)30-15)16-14(29-21(6,7)31-16)11-10-12-27-18(26)22(23,24)25/h10-11,14-17,26H,12-13H2,1-9H3/b11-10+,26-18+/t14-,15-,16-,17-/m1/s1 |
| InChIKey | ZPKFSWVGNAMTJR-BDYKYFMNSA-N |
| XLogP | 5.97 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.99 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|