C40H52N4O6 — CID 102114005
2-[[5-(2,6-dimethoxyphenyl)-1-[4-(heptylcarbamoyl)-2-propan-2-ylphenyl]pyrazole-3-carbonyl]amino]adamantane-2-carboxylic acid (PubChem CID 102114005) has the molecular formula C40H52N4O6 and a molecular weight of 684.88 g/mol. Its IUPAC name is 2-[[5-(2,6-dimethoxyphenyl)-1-[4-(heptylcarbamoyl)-2-propan-2-ylphenyl]pyrazole-3-carbonyl]amino]adamantane-2-carboxylic acid.
| Compound Name | 2-[[5-(2,6-dimethoxyphenyl)-1-[4-(heptylcarbamoyl)-2-propan-2-ylphenyl]pyrazole-3-carbonyl]amino]adamantane-2-carboxylic acid |
|---|---|
| PubChem CID | 102114005 |
| Molecular Formula | C40H52N4O6 |
| Molecular Weight | 684.88 g/mol |
| Exact Mass | 684.39 |
| IUPAC Name | 2-[[5-(2,6-dimethoxyphenyl)-1-[4-(heptylcarbamoyl)-2-propan-2-ylphenyl]pyrazole-3-carbonyl]amino]adamantane-2-carboxylic acid |
| SMILES | CCCCCCCNC(=O)c1ccc(-n2nc(C(=O)NC3(C(=O)O)C4CC5CC(C4)CC3C5)cc2-c2c(OC)cccc2OC)c(C(C)C)c1 |
| InChI | InChI=1S/C40H52N4O6/c1-6-7-8-9-10-16-41-37(45)27-14-15-32(30(22-27)24(2)3)44-33(36-34(49-4)12-11-13-35(36)50-5)23-31(43-44)38(46)42-40(39(47)48)28-18-25-17-26(20-28)21-29(40)19-25/h11-15,22-26,28-29H,6-10,16-21H2,1-5H3,(H,41,45)(H,42,46)(H,47,48) |
| InChIKey | ATQGUZPNNCAALD-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.88 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|