About dimethyl 6-iodo-4-(4-iodoanilino)-2-methyl-1,3-dihydroquinoline-2,4-dicarboxylate
dimethyl 6-iodo-4-(4-iodoanilino)-2-methyl-1,3-dihydroquinoline-2,4-dicarboxylate (PubChem CID 102114208) has the molecular formula C20H20I2N2O4
and a molecular weight of 606.20 g/mol. Its IUPAC name is dimethyl 6-iodo-4-(4-iodoanilino)-2-methyl-1,3-dihydroquinoline-2,4-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 6-iodo-4-(4-iodoanilino)-2-methyl-1,3-dihydroquinoline-2,4-dicarboxylate |
| PubChem CID | 102114208 |
| Molecular Formula | C20H20I2N2O4 |
| Molecular Weight | 606.20 g/mol |
| Exact Mass | 605.95 |
| IUPAC Name | dimethyl 6-iodo-4-(4-iodoanilino)-2-methyl-1,3-dihydroquinoline-2,4-dicarboxylate |
| SMILES | COC(=O)C1(C)CC(Nc2ccc(I)cc2)(C(=O)OC)c2cc(I)ccc2N1 |
| InChI | InChI=1S/C20H20I2N2O4/c1-19(17(25)27-2)11-20(18(26)28-3,23-14-7-4-12(21)5-8-14)15-10-13(22)6-9-16(15)24-19/h4-10,23-24H,11H2,1-3H3 |
| InChIKey | RNDZPYDJXVIDHR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 606.20 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 6-iodo-4-(4-iodoanilino)-2-methyl-1,3-dihydroquinoline-2,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 6-iodo-4-(4-iodoanilino)-2-methyl-1,3-dihydroquinoline-2,4-dicarboxylate?
The IUPAC name of dimethyl 6-iodo-4-(4-iodoanilino)-2-methyl-1,3-dihydroquinoline-2,4-dicarboxylate (CID 102114208) is dimethyl 6-iodo-4-(4-iodoanilino)-2-methyl-1,3-dihydroquinoline-2,4-dicarboxylate.
What is the SMILES notation for dimethyl 6-iodo-4-(4-iodoanilino)-2-methyl-1,3-dihydroquinoline-2,4-dicarboxylate?
The canonical SMILES for dimethyl 6-iodo-4-(4-iodoanilino)-2-methyl-1,3-dihydroquinoline-2,4-dicarboxylate is COC(=O)C1(C)CC(Nc2ccc(I)cc2)(C(=O)OC)c2cc(I)ccc2N1.
What is the InChIKey of dimethyl 6-iodo-4-(4-iodoanilino)-2-methyl-1,3-dihydroquinoline-2,4-dicarboxylate?
The InChIKey is RNDZPYDJXVIDHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20I2N2O4/c1-19(17(25)27-2)11-20(18(26)28-3,23-14-7-4-12(21)5-8-14)15-10-13(22)6-9-16(15)24-19/h4-10,23-24H,11H2,1-3H3.
What are the key properties of dimethyl 6-iodo-4-(4-iodoanilino)-2-methyl-1,3-dihydroquinoline-2,4-dicarboxylate?
dimethyl 6-iodo-4-(4-iodoanilino)-2-methyl-1,3-dihydroquinoline-2,4-dicarboxylate has a molecular weight of 606.20 g/mol, XLogP of 4.12, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 6-iodo-4-(4-iodoanilino)-2-methyl-1,3-dihydroquinoline-2,4-dicarboxylate is sourced from PubChem (CID 102114208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).