C17HN — CID 102114263
1-isocyanohexadeca-1,3,5,7,9,11,13,15-octayne (PubChem CID 102114263) has the molecular formula C17HN and a molecular weight of 219.20 g/mol. Its IUPAC name is 1-isocyanohexadeca-1,3,5,7,9,11,13,15-octayne.
| Compound Name | 1-isocyanohexadeca-1,3,5,7,9,11,13,15-octayne |
|---|---|
| PubChem CID | 102114263 |
| Molecular Formula | C17HN |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.01 |
| IUPAC Name | 1-isocyanohexadeca-1,3,5,7,9,11,13,15-octayne |
| SMILES | [C-]#[N+]C#CC#CC#CC#CC#CC#CC#CC#C |
| InChI | InChI=1S/C17HN/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-2/h1H |
| InChIKey | LQQBKWGWZAUFPG-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|