C17H16O2S4 — CID 102114710
9-hydroxy-3,4,6,7-tetrakis(methylsulfanyl)phenalen-1-one (PubChem CID 102114710) has the molecular formula C17H16O2S4 and a molecular weight of 380.58 g/mol. Its IUPAC name is 9-hydroxy-3,4,6,7-tetrakis(methylsulfanyl)phenalen-1-one.
| Compound Name | 9-hydroxy-3,4,6,7-tetrakis(methylsulfanyl)phenalen-1-one |
|---|---|
| PubChem CID | 102114710 |
| Molecular Formula | C17H16O2S4 |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.00 |
| IUPAC Name | 9-hydroxy-3,4,6,7-tetrakis(methylsulfanyl)phenalen-1-one |
| SMILES | CSC1=CC(=O)c2c(O)cc(SC)c3c(SC)cc(SC)c1c23 |
| InChI | InChI=1S/C17H16O2S4/c1-20-10-5-8(18)14-9(19)6-11(21-2)16-13(23-4)7-12(22-3)15(10)17(14)16/h5-7,18H,1-4H3 |
| InChIKey | FSUBNQKJRQHLHM-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |