About N-[2-[(Z)-(1,2-dimethyl-5-oxoimidazol-4-ylidene)methyl]phenyl]acetamide
N-[2-[(Z)-(1,2-dimethyl-5-oxoimidazol-4-ylidene)methyl]phenyl]acetamide (PubChem CID 102114892) has the molecular formula C14H15N3O2
and a molecular weight of 257.29 g/mol. Its IUPAC name is N-[2-[(Z)-(1,2-dimethyl-5-oxoimidazol-4-ylidene)methyl]phenyl]acetamide.
Molecular Properties
| Compound Name | N-[2-[(Z)-(1,2-dimethyl-5-oxoimidazol-4-ylidene)methyl]phenyl]acetamide |
| PubChem CID | 102114892 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | N-[2-[(Z)-(1,2-dimethyl-5-oxoimidazol-4-ylidene)methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccccc1/C=C1\N=C(C)N(C)C1=O |
| InChI | InChI=1S/C14H15N3O2/c1-9-15-13(14(19)17(9)3)8-11-6-4-5-7-12(11)16-10(2)18/h4-8H,1-3H3,(H,16,18)/b13-8- |
| InChIKey | WIAKRADGKUAVIJ-JYRVWZFOSA-N |
| XLogP | 1.88 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[(Z)-(1,2-dimethyl-5-oxoimidazol-4-ylidene)methyl]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(Z)-(1,2-dimethyl-5-oxoimidazol-4-ylidene)methyl]phenyl]acetamide?
The IUPAC name of N-[2-[(Z)-(1,2-dimethyl-5-oxoimidazol-4-ylidene)methyl]phenyl]acetamide (CID 102114892) is N-[2-[(Z)-(1,2-dimethyl-5-oxoimidazol-4-ylidene)methyl]phenyl]acetamide.
What is the SMILES notation for N-[2-[(Z)-(1,2-dimethyl-5-oxoimidazol-4-ylidene)methyl]phenyl]acetamide?
The canonical SMILES for N-[2-[(Z)-(1,2-dimethyl-5-oxoimidazol-4-ylidene)methyl]phenyl]acetamide is CC(=O)Nc1ccccc1/C=C1\N=C(C)N(C)C1=O.
What is the InChIKey of N-[2-[(Z)-(1,2-dimethyl-5-oxoimidazol-4-ylidene)methyl]phenyl]acetamide?
The InChIKey is WIAKRADGKUAVIJ-JYRVWZFOSA-N. The full InChI is InChI=1S/C14H15N3O2/c1-9-15-13(14(19)17(9)3)8-11-6-4-5-7-12(11)16-10(2)18/h4-8H,1-3H3,(H,16,18)/b13-8-.
What are the key properties of N-[2-[(Z)-(1,2-dimethyl-5-oxoimidazol-4-ylidene)methyl]phenyl]acetamide?
N-[2-[(Z)-(1,2-dimethyl-5-oxoimidazol-4-ylidene)methyl]phenyl]acetamide has a molecular weight of 257.29 g/mol, XLogP of 1.88, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(Z)-(1,2-dimethyl-5-oxoimidazol-4-ylidene)methyl]phenyl]acetamide is sourced from PubChem (CID 102114892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).