C27H57IO4Si2 — CID 102114944
tert-butyl-[(E,4R,5S,6S)-1-iodo-8,8-dimethoxy-3,5-dimethyl-6-tri(propan-2-yl)silyloxyoct-2-en-4-yl]oxy-dimethylsilane (PubChem CID 102114944) has the molecular formula C27H57IO4Si2 and a molecular weight of 628.83 g/mol. Its IUPAC name is tert-butyl-[(E,4R,5S,6S)-1-iodo-8,8-dimethoxy-3,5-dimethyl-6-tri(propan-2-yl)silyloxyoct-2-en-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(E,4R,5S,6S)-1-iodo-8,8-dimethoxy-3,5-dimethyl-6-tri(propan-2-yl)silyloxyoct-2-en-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 102114944 |
| Molecular Formula | C27H57IO4Si2 |
| Molecular Weight | 628.83 g/mol |
| Exact Mass | 628.28 |
| IUPAC Name | tert-butyl-[(E,4R,5S,6S)-1-iodo-8,8-dimethoxy-3,5-dimethyl-6-tri(propan-2-yl)silyloxyoct-2-en-4-yl]oxy-dimethylsilane |
| SMILES | COC(C[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)/C(C)=C/CI)OC |
| InChI | InChI=1S/C27H57IO4Si2/c1-19(2)34(20(3)4,21(5)6)31-24(18-25(29-12)30-13)23(8)26(22(7)16-17-28)32-33(14,15)27(9,10)11/h16,19-21,23-26H,17-18H2,1-15H3/b22-16+/t23-,24-,26-/m0/s1 |
| InChIKey | VXHIFGSPORAEOZ-HDMWWCKJSA-N |
| XLogP | 8.96 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.83 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|