C10H19NO5 — CID 102114974
tert-butyl N-[(1S)-2-hydroxy-1-[(2R,3S)-3-(hydroxymethyl)oxiran-2-yl]ethyl]carbamate (PubChem CID 102114974) has the molecular formula C10H19NO5 and a molecular weight of 233.26 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2-hydroxy-1-[(2R,3S)-3-(hydroxymethyl)oxiran-2-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-2-hydroxy-1-[(2R,3S)-3-(hydroxymethyl)oxiran-2-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 102114974 |
| Molecular Formula | C10H19NO5 |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | tert-butyl N-[(1S)-2-hydroxy-1-[(2R,3S)-3-(hydroxymethyl)oxiran-2-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CO)[C@H]1O[C@H]1CO |
| InChI | InChI=1S/C10H19NO5/c1-10(2,3)16-9(14)11-6(4-12)8-7(5-13)15-8/h6-8,12-13H,4-5H2,1-3H3,(H,11,14)/t6-,7-,8+/m0/s1 |
| InChIKey | NJPCCDWJDVDMIZ-BIIVOSGPSA-N |
| XLogP | -0.37 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|