About (2R,3S)-3-cyclohexyl-N,N-diethyl-2-fluoro-3-hydroxy-2-methylpropanamide
(2R,3S)-3-cyclohexyl-N,N-diethyl-2-fluoro-3-hydroxy-2-methylpropanamide (PubChem CID 102115224) has the molecular formula C14H26FNO2
and a molecular weight of 259.36 g/mol. Its IUPAC name is (2R,3S)-3-cyclohexyl-N,N-diethyl-2-fluoro-3-hydroxy-2-methylpropanamide.
Molecular Properties
| Compound Name | (2R,3S)-3-cyclohexyl-N,N-diethyl-2-fluoro-3-hydroxy-2-methylpropanamide |
| PubChem CID | 102115224 |
| Molecular Formula | C14H26FNO2 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | (2R,3S)-3-cyclohexyl-N,N-diethyl-2-fluoro-3-hydroxy-2-methylpropanamide |
| SMILES | CCN(CC)C(=O)[C@](C)(F)[C@@H](O)C1CCCCC1 |
| InChI | InChI=1S/C14H26FNO2/c1-4-16(5-2)13(18)14(3,15)12(17)11-9-7-6-8-10-11/h11-12,17H,4-10H2,1-3H3/t12-,14+/m0/s1 |
| InChIKey | WQOLCVYQWHGSNH-GXTWGEPZSA-N |
| XLogP | 2.52 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R,3S)-3-cyclohexyl-N,N-diethyl-2-fluoro-3-hydroxy-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3S)-3-cyclohexyl-N,N-diethyl-2-fluoro-3-hydroxy-2-methylpropanamide?
The IUPAC name of (2R,3S)-3-cyclohexyl-N,N-diethyl-2-fluoro-3-hydroxy-2-methylpropanamide (CID 102115224) is (2R,3S)-3-cyclohexyl-N,N-diethyl-2-fluoro-3-hydroxy-2-methylpropanamide.
What is the SMILES notation for (2R,3S)-3-cyclohexyl-N,N-diethyl-2-fluoro-3-hydroxy-2-methylpropanamide?
The canonical SMILES for (2R,3S)-3-cyclohexyl-N,N-diethyl-2-fluoro-3-hydroxy-2-methylpropanamide is CCN(CC)C(=O)[C@](C)(F)[C@@H](O)C1CCCCC1.
What is the InChIKey of (2R,3S)-3-cyclohexyl-N,N-diethyl-2-fluoro-3-hydroxy-2-methylpropanamide?
The InChIKey is WQOLCVYQWHGSNH-GXTWGEPZSA-N. The full InChI is InChI=1S/C14H26FNO2/c1-4-16(5-2)13(18)14(3,15)12(17)11-9-7-6-8-10-11/h11-12,17H,4-10H2,1-3H3/t12-,14+/m0/s1.
What are the key properties of (2R,3S)-3-cyclohexyl-N,N-diethyl-2-fluoro-3-hydroxy-2-methylpropanamide?
(2R,3S)-3-cyclohexyl-N,N-diethyl-2-fluoro-3-hydroxy-2-methylpropanamide has a molecular weight of 259.36 g/mol, XLogP of 2.52, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-3-cyclohexyl-N,N-diethyl-2-fluoro-3-hydroxy-2-methylpropanamide is sourced from PubChem (CID 102115224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).