C20H28O11 — CID 102115259
methyl 3-[[(2R,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]methyl]but-3-enoate (PubChem CID 102115259) has the molecular formula C20H28O11 and a molecular weight of 444.43 g/mol. Its IUPAC name is methyl 3-[[(2R,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]methyl]but-3-enoate.
| Compound Name | methyl 3-[[(2R,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]methyl]but-3-enoate |
|---|---|
| PubChem CID | 102115259 |
| Molecular Formula | C20H28O11 |
| Molecular Weight | 444.43 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | methyl 3-[[(2R,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]methyl]but-3-enoate |
| SMILES | C=C(CC(=O)OC)C[C@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C20H28O11/c1-10(8-17(25)26-6)7-15-18(28-12(3)22)20(30-14(5)24)19(29-13(4)23)16(31-15)9-27-11(2)21/h15-16,18-20H,1,7-9H2,2-6H3/t15-,16-,18+,19-,20-/m1/s1 |
| InChIKey | QBZNTBNZTFVBEW-SCQOQHIRSA-N |
| XLogP | 0.62 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.43 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|