C30H34N4O3 — CID 102115764
5-[2-[4-[3-(2,6-dimethylpiperidin-1-yl)propoxy]phenyl]acetyl]-11H-pyrido[2,3-b][1,4]benzodiazepin-6-one (PubChem CID 102115764) has the molecular formula C30H34N4O3 and a molecular weight of 498.63 g/mol. Its IUPAC name is 5-[2-[4-[3-(2,6-dimethylpiperidin-1-yl)propoxy]phenyl]acetyl]-11H-pyrido[2,3-b][1,4]benzodiazepin-6-one.
| Compound Name | 5-[2-[4-[3-(2,6-dimethylpiperidin-1-yl)propoxy]phenyl]acetyl]-11H-pyrido[2,3-b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 102115764 |
| Molecular Formula | C30H34N4O3 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | 5-[2-[4-[3-(2,6-dimethylpiperidin-1-yl)propoxy]phenyl]acetyl]-11H-pyrido[2,3-b][1,4]benzodiazepin-6-one |
| SMILES | CC1CCCC(C)N1CCCOc1ccc(CC(=O)N2C(=O)c3ccccc3Nc3ncccc32)cc1 |
| InChI | InChI=1S/C30H34N4O3/c1-21-8-5-9-22(2)33(21)18-7-19-37-24-15-13-23(14-16-24)20-28(35)34-27-12-6-17-31-29(27)32-26-11-4-3-10-25(26)30(34)36/h3-4,6,10-17,21-22H,5,7-9,18-20H2,1-2H3,(H,31,32) |
| InChIKey | WZUFKFBWQGACJC-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|