C14H18O2 — CID 102117186
(4R,4aS)-1-acetyl-4,7-dimethyl-4,4a,5,6-tetrahydro-3H-naphthalen-2-one (PubChem CID 102117186) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is (4R,4aS)-1-acetyl-4,7-dimethyl-4,4a,5,6-tetrahydro-3H-naphthalen-2-one.
| Compound Name | (4R,4aS)-1-acetyl-4,7-dimethyl-4,4a,5,6-tetrahydro-3H-naphthalen-2-one |
|---|---|
| PubChem CID | 102117186 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | (4R,4aS)-1-acetyl-4,7-dimethyl-4,4a,5,6-tetrahydro-3H-naphthalen-2-one |
| SMILES | CC(=O)C1=C2C=C(C)CC[C@H]2[C@H](C)CC1=O |
| InChI | InChI=1S/C14H18O2/c1-8-4-5-11-9(2)7-13(16)14(10(3)15)12(11)6-8/h6,9,11H,4-5,7H2,1-3H3/t9-,11+/m1/s1 |
| InChIKey | JGGPAEFEKFAXSS-KOLCDFICSA-N |
| XLogP | 2.84 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|