C16H11ClF3NO3 — CID 102119601
3-(4-chloro-2-hydroxyphenyl)-3-hydroxy-1-methyl-6-(trifluoromethyl)indol-2-one (PubChem CID 102119601) has the molecular formula C16H11ClF3NO3 and a molecular weight of 357.72 g/mol. Its IUPAC name is 3-(4-chloro-2-hydroxyphenyl)-3-hydroxy-1-methyl-6-(trifluoromethyl)indol-2-one.
| Compound Name | 3-(4-chloro-2-hydroxyphenyl)-3-hydroxy-1-methyl-6-(trifluoromethyl)indol-2-one |
|---|---|
| PubChem CID | 102119601 |
| Molecular Formula | C16H11ClF3NO3 |
| Molecular Weight | 357.72 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 3-(4-chloro-2-hydroxyphenyl)-3-hydroxy-1-methyl-6-(trifluoromethyl)indol-2-one |
| SMILES | CN1C(=O)C(O)(c2ccc(Cl)cc2O)c2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C16H11ClF3NO3/c1-21-12-6-8(16(18,19)20)2-4-10(12)15(24,14(21)23)11-5-3-9(17)7-13(11)22/h2-7,22,24H,1H3 |
| InChIKey | XURUIKKUBLVABN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.72 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |