C21H19F3N2O2S — CID 102120400
ethyl 4-methyl-6-phenyl-2-sulfanylidene-3-[2-(trifluoromethyl)phenyl]-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 102120400) has the molecular formula C21H19F3N2O2S and a molecular weight of 420.46 g/mol. Its IUPAC name is ethyl 4-methyl-6-phenyl-2-sulfanylidene-3-[2-(trifluoromethyl)phenyl]-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | ethyl 4-methyl-6-phenyl-2-sulfanylidene-3-[2-(trifluoromethyl)phenyl]-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 102120400 |
| Molecular Formula | C21H19F3N2O2S |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | ethyl 4-methyl-6-phenyl-2-sulfanylidene-3-[2-(trifluoromethyl)phenyl]-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N(c2ccccc2C(F)(F)F)C(=S)NC1c1ccccc1 |
| InChI | InChI=1S/C21H19F3N2O2S/c1-3-28-19(27)17-13(2)26(16-12-8-7-11-15(16)21(22,23)24)20(29)25-18(17)14-9-5-4-6-10-14/h4-12,18H,3H2,1-2H3,(H,25,29) |
| InChIKey | PQZUDGFTPUQVNZ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|