C20H29NO2 — CID 102120471
(2S)-2-[(4aS)-7-methoxy-4a,8-dimethyl-4,7-dihydro-3H-naphthalen-2-yl]-1-pyrrolidin-1-ylpropan-1-one (PubChem CID 102120471) has the molecular formula C20H29NO2 and a molecular weight of 315.46 g/mol. Its IUPAC name is (2S)-2-[(4aS)-7-methoxy-4a,8-dimethyl-4,7-dihydro-3H-naphthalen-2-yl]-1-pyrrolidin-1-ylpropan-1-one.
| Compound Name | (2S)-2-[(4aS)-7-methoxy-4a,8-dimethyl-4,7-dihydro-3H-naphthalen-2-yl]-1-pyrrolidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 102120471 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | (2S)-2-[(4aS)-7-methoxy-4a,8-dimethyl-4,7-dihydro-3H-naphthalen-2-yl]-1-pyrrolidin-1-ylpropan-1-one |
| SMILES | COC1C=C[C@]2(C)CCC([C@H](C)C(=O)N3CCCC3)=CC2=C1C |
| InChI | InChI=1S/C20H29NO2/c1-14(19(22)21-11-5-6-12-21)16-7-9-20(3)10-8-18(23-4)15(2)17(20)13-16/h8,10,13-14,18H,5-7,9,11-12H2,1-4H3/t14-,18?,20-/m0/s1 |
| InChIKey | FBIJRYNPDANTEU-GUVZCDSQSA-N |
| XLogP | 3.87 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|