C21H26N2O3 — CID 102120632
methyl (1R,10S,12R,13E,18R)-13-ethylidene-10-hydroxy-8-methyl-8,15-diazapentacyclo[10.5.1.01,9.02,7.09,15]octadeca-2,4,6-triene-18-carboxylate (PubChem CID 102120632) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is methyl (1R,10S,12R,13E,18R)-13-ethylidene-10-hydroxy-8-methyl-8,15-diazapentacyclo[10.5.1.01,9.02,7.09,15]octadeca-2,4,6-triene-18-carboxylate.
| Compound Name | methyl (1R,10S,12R,13E,18R)-13-ethylidene-10-hydroxy-8-methyl-8,15-diazapentacyclo[10.5.1.01,9.02,7.09,15]octadeca-2,4,6-triene-18-carboxylate |
|---|---|
| PubChem CID | 102120632 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | methyl (1R,10S,12R,13E,18R)-13-ethylidene-10-hydroxy-8-methyl-8,15-diazapentacyclo[10.5.1.01,9.02,7.09,15]octadeca-2,4,6-triene-18-carboxylate |
| SMILES | C/C=C1/CN2CC[C@@]34c5ccccc5N(C)C23C(O)C[C@@H]1[C@H]4C(=O)OC |
| InChI | InChI=1S/C21H26N2O3/c1-4-13-12-23-10-9-20-15-7-5-6-8-16(15)22(2)21(20,23)17(24)11-14(13)18(20)19(25)26-3/h4-8,14,17-18,24H,9-12H2,1-3H3/b13-4-/t14-,17?,18-,20-,21?/m0/s1 |
| InChIKey | CFKUJHVLEYIZOQ-QSHVCTBOSA-N |
| XLogP | 1.91 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|