C12H17BrO — CID 102121003
(3S,4aS)-3-bromo-1,4a-dimethyl-3,4,5,6,7,8-hexahydronaphthalen-2-one (PubChem CID 102121003) has the molecular formula C12H17BrO and a molecular weight of 257.17 g/mol. Its IUPAC name is (3S,4aS)-3-bromo-1,4a-dimethyl-3,4,5,6,7,8-hexahydronaphthalen-2-one.
| Compound Name | (3S,4aS)-3-bromo-1,4a-dimethyl-3,4,5,6,7,8-hexahydronaphthalen-2-one |
|---|---|
| PubChem CID | 102121003 |
| Molecular Formula | C12H17BrO |
| Molecular Weight | 257.17 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | (3S,4aS)-3-bromo-1,4a-dimethyl-3,4,5,6,7,8-hexahydronaphthalen-2-one |
| SMILES | CC1=C2CCCC[C@@]2(C)C[C@H](Br)C1=O |
| InChI | InChI=1S/C12H17BrO/c1-8-9-5-3-4-6-12(9,2)7-10(13)11(8)14/h10H,3-7H2,1-2H3/t10-,12-/m0/s1 |
| InChIKey | OYHWBLKPMKMFFB-JQWIXIFHSA-N |
| XLogP | 3.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.17 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|