C12H19ClO7 — CID 102121133
methyl (3aR,4R,6R,6aR)-4-chloro-6-(methoxymethoxymethyl)-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4-carboxylate (PubChem CID 102121133) has the molecular formula C12H19ClO7 and a molecular weight of 310.73 g/mol. Its IUPAC name is methyl (3aR,4R,6R,6aR)-4-chloro-6-(methoxymethoxymethyl)-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4-carboxylate.
| Compound Name | methyl (3aR,4R,6R,6aR)-4-chloro-6-(methoxymethoxymethyl)-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4-carboxylate |
|---|---|
| PubChem CID | 102121133 |
| Molecular Formula | C12H19ClO7 |
| Molecular Weight | 310.73 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | methyl (3aR,4R,6R,6aR)-4-chloro-6-(methoxymethoxymethyl)-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4-carboxylate |
| SMILES | COCOC[C@H]1O[C@](Cl)(C(=O)OC)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C12H19ClO7/c1-11(2)19-8-7(5-17-6-15-3)18-12(13,9(8)20-11)10(14)16-4/h7-9H,5-6H2,1-4H3/t7-,8-,9-,12+/m1/s1 |
| InChIKey | NWLWADJGMDNEHW-HNBLOZHYSA-N |
| XLogP | 0.63 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.73 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|