C24H21FN4O5 — CID 102121388
methyl 3-[2-[6-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-5-fluorobenzotriazol-1-yl]phenoxy]propanoate (PubChem CID 102121388) has the molecular formula C24H21FN4O5 and a molecular weight of 464.45 g/mol. Its IUPAC name is methyl 3-[2-[6-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-5-fluorobenzotriazol-1-yl]phenoxy]propanoate.
| Compound Name | methyl 3-[2-[6-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-5-fluorobenzotriazol-1-yl]phenoxy]propanoate |
|---|---|
| PubChem CID | 102121388 |
| Molecular Formula | C24H21FN4O5 |
| Molecular Weight | 464.45 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | methyl 3-[2-[6-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-5-fluorobenzotriazol-1-yl]phenoxy]propanoate |
| SMILES | COC(=O)CCOc1ccccc1-n1nnc2cc(F)c(N3C(=O)C4=C(CCCC4)C3=O)cc21 |
| InChI | InChI=1S/C24H21FN4O5/c1-33-22(30)10-11-34-21-9-5-4-8-18(21)29-20-13-19(16(25)12-17(20)26-27-29)28-23(31)14-6-2-3-7-15(14)24(28)32/h4-5,8-9,12-13H,2-3,6-7,10-11H2,1H3 |
| InChIKey | KBYIPXONCAZMNG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 103.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|