C25H26O7 — CID 102121475
5-[(2R,3S)-3-hydroxy-5-[2-(3-hydroxyphenyl)ethyl]-7-methoxy-3,4-dihydro-2H-chromen-2-yl]-3-methoxybenzene-1,2-diol (PubChem CID 102121475) has the molecular formula C25H26O7 and a molecular weight of 438.48 g/mol. Its IUPAC name is 5-[(2R,3S)-3-hydroxy-5-[2-(3-hydroxyphenyl)ethyl]-7-methoxy-3,4-dihydro-2H-chromen-2-yl]-3-methoxybenzene-1,2-diol.
| Compound Name | 5-[(2R,3S)-3-hydroxy-5-[2-(3-hydroxyphenyl)ethyl]-7-methoxy-3,4-dihydro-2H-chromen-2-yl]-3-methoxybenzene-1,2-diol |
|---|---|
| PubChem CID | 102121475 |
| Molecular Formula | C25H26O7 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 5-[(2R,3S)-3-hydroxy-5-[2-(3-hydroxyphenyl)ethyl]-7-methoxy-3,4-dihydro-2H-chromen-2-yl]-3-methoxybenzene-1,2-diol |
| SMILES | COc1cc(CCc2cccc(O)c2)c2c(c1)O[C@H](c1cc(O)c(O)c(OC)c1)[C@@H](O)C2 |
| InChI | InChI=1S/C25H26O7/c1-30-18-9-15(7-6-14-4-3-5-17(26)8-14)19-13-21(28)25(32-22(19)12-18)16-10-20(27)24(29)23(11-16)31-2/h3-5,8-12,21,25-29H,6-7,13H2,1-2H3/t21-,25+/m0/s1 |
| InChIKey | RVILORKPEPKFSF-SQJMNOBHSA-N |
| XLogP | 3.64 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|