C25H24O6 — CID 102121476
(10S,11R)-10-(4-hydroxy-3-methoxyphenyl)-1-methoxy-6,9,10,11-tetrahydro-5H-naphtho[1,2-g]chromene-3,11-diol (PubChem CID 102121476) has the molecular formula C25H24O6 and a molecular weight of 420.46 g/mol. Its IUPAC name is (10S,11R)-10-(4-hydroxy-3-methoxyphenyl)-1-methoxy-6,9,10,11-tetrahydro-5H-naphtho[1,2-g]chromene-3,11-diol.
| Compound Name | (10S,11R)-10-(4-hydroxy-3-methoxyphenyl)-1-methoxy-6,9,10,11-tetrahydro-5H-naphtho[1,2-g]chromene-3,11-diol |
|---|---|
| PubChem CID | 102121476 |
| Molecular Formula | C25H24O6 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | (10S,11R)-10-(4-hydroxy-3-methoxyphenyl)-1-methoxy-6,9,10,11-tetrahydro-5H-naphtho[1,2-g]chromene-3,11-diol |
| SMILES | COc1cc([C@H]2COc3cc4c(cc3[C@@H]2O)-c2c(cc(O)cc2OC)CC4)ccc1O |
| InChI | InChI=1S/C25H24O6/c1-29-22-9-14(5-6-20(22)27)19-12-31-21-8-13-3-4-15-7-16(26)10-23(30-2)24(15)17(13)11-18(21)25(19)28/h5-11,19,25-28H,3-4,12H2,1-2H3/t19-,25+/m1/s1 |
| InChIKey | MLJDLFSBMGJEHK-CLOONOSVSA-N |
| XLogP | 4.09 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |