C29H41F3O5S3Si — CID 102121813
[3-[2-[1-[tert-butyl(diphenyl)silyl]oxy-2-methylpropan-2-yl]-1,3-dithian-2-yl]-2-hydroxybutyl] trifluoromethanesulfonate (PubChem CID 102121813) has the molecular formula C29H41F3O5S3Si and a molecular weight of 650.92 g/mol. Its IUPAC name is [3-[2-[1-[tert-butyl(diphenyl)silyl]oxy-2-methylpropan-2-yl]-1,3-dithian-2-yl]-2-hydroxybutyl] trifluoromethanesulfonate.
| Compound Name | [3-[2-[1-[tert-butyl(diphenyl)silyl]oxy-2-methylpropan-2-yl]-1,3-dithian-2-yl]-2-hydroxybutyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 102121813 |
| Molecular Formula | C29H41F3O5S3Si |
| Molecular Weight | 650.92 g/mol |
| Exact Mass | 650.18 |
| IUPAC Name | [3-[2-[1-[tert-butyl(diphenyl)silyl]oxy-2-methylpropan-2-yl]-1,3-dithian-2-yl]-2-hydroxybutyl] trifluoromethanesulfonate |
| SMILES | CC(C(O)COS(=O)(=O)C(F)(F)F)C1(C(C)(C)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)SCCCS1 |
| InChI | InChI=1S/C29H41F3O5S3Si/c1-22(25(33)20-36-40(34,35)29(30,31)32)28(38-18-13-19-39-28)27(5,6)21-37-41(26(2,3)4,23-14-9-7-10-15-23)24-16-11-8-12-17-24/h7-12,14-17,22,25,33H,13,18-21H2,1-6H3 |
| InChIKey | UMFPCHDCMCGAQU-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.92 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|