C36H43NO3 — CID 102122090
4-butyl-1-(4-methoxyphenyl)-3-[(1R,2R,3R,4S)-4,7,7-trimethyl-3-naphthalen-1-ylbicyclo[2.2.1]heptane-2-carbonyl]pyrrolidin-2-one (PubChem CID 102122090) has the molecular formula C36H43NO3 and a molecular weight of 537.74 g/mol. Its IUPAC name is 4-butyl-1-(4-methoxyphenyl)-3-[(1R,2R,3R,4S)-4,7,7-trimethyl-3-naphthalen-1-ylbicyclo[2.2.1]heptane-2-carbonyl]pyrrolidin-2-one.
| Compound Name | 4-butyl-1-(4-methoxyphenyl)-3-[(1R,2R,3R,4S)-4,7,7-trimethyl-3-naphthalen-1-ylbicyclo[2.2.1]heptane-2-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 102122090 |
| Molecular Formula | C36H43NO3 |
| Molecular Weight | 537.74 g/mol |
| Exact Mass | 537.32 |
| IUPAC Name | 4-butyl-1-(4-methoxyphenyl)-3-[(1R,2R,3R,4S)-4,7,7-trimethyl-3-naphthalen-1-ylbicyclo[2.2.1]heptane-2-carbonyl]pyrrolidin-2-one |
| SMILES | CCCCC1CN(c2ccc(OC)cc2)C(=O)C1C(=O)[C@@H]1[C@H]2CC[C@@](C)([C@@H]1c1cccc3ccccc13)C2(C)C |
| InChI | InChI=1S/C36H43NO3/c1-6-7-11-24-22-37(25-16-18-26(40-5)19-17-25)34(39)30(24)33(38)31-29-20-21-36(4,35(29,2)3)32(31)28-15-10-13-23-12-8-9-14-27(23)28/h8-10,12-19,24,29-32H,6-7,11,20-22H2,1-5H3/t24?,29-,30?,31-,32-,36+/m1/s1 |
| InChIKey | TURMMMBJSSECMG-XMEBHBHJSA-N |
| XLogP | 8.04 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.74 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|