C13H13F5O — CID 102122277
(E)-3-ethyl-1-(2,3,4,5,6-pentafluorophenyl)pent-3-en-1-ol (PubChem CID 102122277) has the molecular formula C13H13F5O and a molecular weight of 280.24 g/mol. Its IUPAC name is (E)-3-ethyl-1-(2,3,4,5,6-pentafluorophenyl)pent-3-en-1-ol.
| Compound Name | (E)-3-ethyl-1-(2,3,4,5,6-pentafluorophenyl)pent-3-en-1-ol |
|---|---|
| PubChem CID | 102122277 |
| Molecular Formula | C13H13F5O |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | (E)-3-ethyl-1-(2,3,4,5,6-pentafluorophenyl)pent-3-en-1-ol |
| SMILES | C/C=C(\CC)CC(O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H13F5O/c1-3-6(4-2)5-7(19)8-9(14)11(16)13(18)12(17)10(8)15/h3,7,19H,4-5H2,1-2H3/b6-3+ |
| InChIKey | SWBCPKXEJSKTJR-ZZXKWVIFSA-N |
| XLogP | 4.16 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|