C31H50O11 — CID 102122304
[(2S,3S,4E,6S)-6-[(2R,3R)-2-acetyloxy-3-hydroxybutyl]-2-[(E)-4-(1,3-dioxan-2-yl)-2-methylbut-3-en-2-yl]-2-hydroxy-4-(2-methoxy-2-oxoethylidene)oxan-3-yl] octanoate (PubChem CID 102122304) has the molecular formula C31H50O11 and a molecular weight of 598.73 g/mol. Its IUPAC name is [(2S,3S,4E,6S)-6-[(2R,3R)-2-acetyloxy-3-hydroxybutyl]-2-[(E)-4-(1,3-dioxan-2-yl)-2-methylbut-3-en-2-yl]-2-hydroxy-4-(2-methoxy-2-oxoethylidene)oxan-3-yl] octanoate.
| Compound Name | [(2S,3S,4E,6S)-6-[(2R,3R)-2-acetyloxy-3-hydroxybutyl]-2-[(E)-4-(1,3-dioxan-2-yl)-2-methylbut-3-en-2-yl]-2-hydroxy-4-(2-methoxy-2-oxoethylidene)oxan-3-yl] octanoate |
|---|---|
| PubChem CID | 102122304 |
| Molecular Formula | C31H50O11 |
| Molecular Weight | 598.73 g/mol |
| Exact Mass | 598.34 |
| IUPAC Name | [(2S,3S,4E,6S)-6-[(2R,3R)-2-acetyloxy-3-hydroxybutyl]-2-[(E)-4-(1,3-dioxan-2-yl)-2-methylbut-3-en-2-yl]-2-hydroxy-4-(2-methoxy-2-oxoethylidene)oxan-3-yl] octanoate |
| SMILES | CCCCCCCC(=O)O[C@H]1/C(=C/C(=O)OC)C[C@@H](C[C@@H](OC(C)=O)[C@@H](C)O)O[C@@]1(O)C(C)(C)/C=C/C1OCCCO1 |
| InChI | InChI=1S/C31H50O11/c1-7-8-9-10-11-13-26(34)41-29-23(19-27(35)37-6)18-24(20-25(21(2)32)40-22(3)33)42-31(29,36)30(4,5)15-14-28-38-16-12-17-39-28/h14-15,19,21,24-25,28-29,32,36H,7-13,16-18,20H2,1-6H3/b15-14+,23-19+/t21-,24+,25-,29+,31-/m1/s1 |
| InChIKey | BINBQFRCWCJADC-WWUROYHRSA-N |
| XLogP | 3.88 |
| TPSA | 147.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.73 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|