C18H26N2O2 — CID 102122876
N'-tert-butyl-N'-(cyclobutanecarbonyl)-4-ethylbenzohydrazide (PubChem CID 102122876) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is N'-tert-butyl-N'-(cyclobutanecarbonyl)-4-ethylbenzohydrazide.
| Compound Name | N'-tert-butyl-N'-(cyclobutanecarbonyl)-4-ethylbenzohydrazide |
|---|---|
| PubChem CID | 102122876 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | N'-tert-butyl-N'-(cyclobutanecarbonyl)-4-ethylbenzohydrazide |
| SMILES | CCc1ccc(C(=O)NN(C(=O)C2CCC2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H26N2O2/c1-5-13-9-11-14(12-10-13)16(21)19-20(18(2,3)4)17(22)15-7-6-8-15/h9-12,15H,5-8H2,1-4H3,(H,19,21) |
| InChIKey | NRCCECQTIHWOJI-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|