About (2R,4R)-2-naphthalen-1-yl-4-propan-2-yl-1,3-dioxane
(2R,4R)-2-naphthalen-1-yl-4-propan-2-yl-1,3-dioxane (PubChem CID 102122949) has the molecular formula C17H20O2
and a molecular weight of 256.35 g/mol. Its IUPAC name is (2R,4R)-2-naphthalen-1-yl-4-propan-2-yl-1,3-dioxane.
Molecular Properties
| Compound Name | (2R,4R)-2-naphthalen-1-yl-4-propan-2-yl-1,3-dioxane |
| PubChem CID | 102122949 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | (2R,4R)-2-naphthalen-1-yl-4-propan-2-yl-1,3-dioxane |
| SMILES | CC(C)[C@H]1CCO[C@@H](c2cccc3ccccc23)O1 |
| InChI | InChI=1S/C17H20O2/c1-12(2)16-10-11-18-17(19-16)15-9-5-7-13-6-3-4-8-14(13)15/h3-9,12,16-17H,10-11H2,1-2H3/t16-,17-/m1/s1 |
| InChIKey | NWRXIACRIURJFX-IAGOWNOFSA-N |
| XLogP | 4.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R,4R)-2-naphthalen-1-yl-4-propan-2-yl-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,4R)-2-naphthalen-1-yl-4-propan-2-yl-1,3-dioxane?
The IUPAC name of (2R,4R)-2-naphthalen-1-yl-4-propan-2-yl-1,3-dioxane (CID 102122949) is (2R,4R)-2-naphthalen-1-yl-4-propan-2-yl-1,3-dioxane.
What is the SMILES notation for (2R,4R)-2-naphthalen-1-yl-4-propan-2-yl-1,3-dioxane?
The canonical SMILES for (2R,4R)-2-naphthalen-1-yl-4-propan-2-yl-1,3-dioxane is CC(C)[C@H]1CCO[C@@H](c2cccc3ccccc23)O1.
What is the InChIKey of (2R,4R)-2-naphthalen-1-yl-4-propan-2-yl-1,3-dioxane?
The InChIKey is NWRXIACRIURJFX-IAGOWNOFSA-N. The full InChI is InChI=1S/C17H20O2/c1-12(2)16-10-11-18-17(19-16)15-9-5-7-13-6-3-4-8-14(13)15/h3-9,12,16-17H,10-11H2,1-2H3/t16-,17-/m1/s1.
What are the key properties of (2R,4R)-2-naphthalen-1-yl-4-propan-2-yl-1,3-dioxane?
(2R,4R)-2-naphthalen-1-yl-4-propan-2-yl-1,3-dioxane has a molecular weight of 256.35 g/mol, XLogP of 4.30, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,4R)-2-naphthalen-1-yl-4-propan-2-yl-1,3-dioxane is sourced from PubChem (CID 102122949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).