About 5-amino-3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazole-4-sulfonic acid
5-amino-3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazole-4-sulfonic acid (PubChem CID 102123036) has the molecular formula C11H5Cl2F3N4O3S
and a molecular weight of 401.15 g/mol. Its IUPAC name is 5-amino-3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazole-4-sulfonic acid.
Molecular Properties
| Compound Name | 5-amino-3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazole-4-sulfonic acid |
| PubChem CID | 102123036 |
| Molecular Formula | C11H5Cl2F3N4O3S |
| Molecular Weight | 401.15 g/mol |
| Exact Mass | 399.94 |
| IUPAC Name | 5-amino-3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazole-4-sulfonic acid |
| SMILES | N#Cc1nn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)c(N)c1S(=O)(=O)O |
| InChI | InChI=1S/C11H5Cl2F3N4O3S/c12-5-1-4(11(14,15)16)2-6(13)8(5)20-10(18)9(24(21,22)23)7(3-17)19-20/h1-2H,18H2,(H,21,22,23) |
| InChIKey | ABOHYNBXDJHVHB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 122.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.15 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazole-4-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazole-4-sulfonic acid?
The IUPAC name of 5-amino-3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazole-4-sulfonic acid (CID 102123036) is 5-amino-3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazole-4-sulfonic acid.
What is the SMILES notation for 5-amino-3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazole-4-sulfonic acid?
The canonical SMILES for 5-amino-3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazole-4-sulfonic acid is N#Cc1nn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)c(N)c1S(=O)(=O)O.
What is the InChIKey of 5-amino-3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazole-4-sulfonic acid?
The InChIKey is ABOHYNBXDJHVHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H5Cl2F3N4O3S/c12-5-1-4(11(14,15)16)2-6(13)8(5)20-10(18)9(24(21,22)23)7(3-17)19-20/h1-2H,18H2,(H,21,22,23).
What are the key properties of 5-amino-3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazole-4-sulfonic acid?
5-amino-3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazole-4-sulfonic acid has a molecular weight of 401.15 g/mol, XLogP of 2.90, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazole-4-sulfonic acid is sourced from PubChem (CID 102123036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).