About CID 102123669
CID 102123669 (PubChem CID 102123669) has the molecular formula CHCl3P
and a molecular weight of 150.35 g/mol.
Molecular Properties
| Compound Name | CID 102123669 |
| PubChem CID | 102123669 |
| Molecular Formula | CHCl3P |
| Molecular Weight | 150.35 g/mol |
| Exact Mass | 148.89 |
| IUPAC Name | — |
| SMILES | Cl[CH]P(Cl)Cl |
| InChI | InChI=1S/CHCl3P/c2-1-5(3)4/h1H |
| InChIKey | DUPAJPYRJWRGOE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.35 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 102123669 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102123669?
The IUPAC name of CID 102123669 (CID 102123669) is not available.
What is the SMILES notation for CID 102123669?
The canonical SMILES for CID 102123669 is Cl[CH]P(Cl)Cl.
What is the InChIKey of CID 102123669?
The InChIKey is DUPAJPYRJWRGOE-UHFFFAOYSA-N. The full InChI is InChI=1S/CHCl3P/c2-1-5(3)4/h1H.
What are the key properties of CID 102123669?
CID 102123669 has a molecular weight of 150.35 g/mol, XLogP of 3.13, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102123669 is sourced from PubChem (CID 102123669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).