C13H15ClN2O2 — CID 102123810
methyl (1S,2S,4R)-2-(6-chloro-3-pyridinyl)-7-azabicyclo[2.2.1]heptane-7-carboxylate (PubChem CID 102123810) has the molecular formula C13H15ClN2O2 and a molecular weight of 266.73 g/mol. Its IUPAC name is methyl (1S,2S,4R)-2-(6-chloro-3-pyridinyl)-7-azabicyclo[2.2.1]heptane-7-carboxylate.
| Compound Name | methyl (1S,2S,4R)-2-(6-chloro-3-pyridinyl)-7-azabicyclo[2.2.1]heptane-7-carboxylate |
|---|---|
| PubChem CID | 102123810 |
| Molecular Formula | C13H15ClN2O2 |
| Molecular Weight | 266.73 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | methyl (1S,2S,4R)-2-(6-chloro-3-pyridinyl)-7-azabicyclo[2.2.1]heptane-7-carboxylate |
| SMILES | COC(=O)N1[C@@H]2CC[C@H]1[C@H](c1ccc(Cl)nc1)C2 |
| InChI | InChI=1S/C13H15ClN2O2/c1-18-13(17)16-9-3-4-11(16)10(6-9)8-2-5-12(14)15-7-8/h2,5,7,9-11H,3-4,6H2,1H3/t9-,10+,11+/m1/s1 |
| InChIKey | MTBXKSJYQUUYAQ-VWYCJHECSA-N |
| XLogP | 2.82 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.73 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|