C36H40Br2O10P2 — CID 102123835
(11,23-dibromo-27-diethoxyphosphoryloxy-26,28-dihydroxy-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaenyl) diethyl phosphate (PubChem CID 102123835) has the molecular formula C36H40Br2O10P2 and a molecular weight of 854.46 g/mol. Its IUPAC name is (11,23-dibromo-27-diethoxyphosphoryloxy-26,28-dihydroxy-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaenyl) diethyl phosphate.
| Compound Name | (11,23-dibromo-27-diethoxyphosphoryloxy-26,28-dihydroxy-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaenyl) diethyl phosphate |
|---|---|
| PubChem CID | 102123835 |
| Molecular Formula | C36H40Br2O10P2 |
| Molecular Weight | 854.46 g/mol |
| Exact Mass | 852.05 |
| IUPAC Name | (11,23-dibromo-27-diethoxyphosphoryloxy-26,28-dihydroxy-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaenyl) diethyl phosphate |
| SMILES | CCOP(=O)(OCC)Oc1c2cc(Br)cc1Cc1cccc(c1O)Cc1cc(Br)cc(c1OP(=O)(OCC)OCC)Cc1cccc(c1O)C2 |
| InChI | InChI=1S/C36H40Br2O10P2/c1-5-43-49(41,44-6-2)47-35-27-15-23-11-9-13-25(33(23)39)17-29-21-32(38)22-30(36(29)48-50(42,45-7-3)46-8-4)18-26-14-10-12-24(34(26)40)16-28(35)20-31(37)19-27/h9-14,19-22,39-40H,5-8,15-18H2,1-4H3 |
| InChIKey | YAVRVCUOJPZUKV-UHFFFAOYSA-N |
| XLogP | 10.42 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.46 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|