C19H26Si — CID 102123922
dimethyl-[(1E,2R)-1-[(1R,4S,7R)-7-methyl-2-bicyclo[2.2.1]hept-5-enylidene]propan-2-yl]-phenylsilane (PubChem CID 102123922) has the molecular formula C19H26Si and a molecular weight of 282.50 g/mol. Its IUPAC name is dimethyl-[(1E,2R)-1-[(1R,4S,7R)-7-methyl-2-bicyclo[2.2.1]hept-5-enylidene]propan-2-yl]-phenylsilane.
| Compound Name | dimethyl-[(1E,2R)-1-[(1R,4S,7R)-7-methyl-2-bicyclo[2.2.1]hept-5-enylidene]propan-2-yl]-phenylsilane |
|---|---|
| PubChem CID | 102123922 |
| Molecular Formula | C19H26Si |
| Molecular Weight | 282.50 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | dimethyl-[(1E,2R)-1-[(1R,4S,7R)-7-methyl-2-bicyclo[2.2.1]hept-5-enylidene]propan-2-yl]-phenylsilane |
| SMILES | C[C@@H]1[C@@H]2C=C[C@H]1/C(=C/[C@@H](C)[Si](C)(C)c1ccccc1)C2 |
| InChI | InChI=1S/C19H26Si/c1-14(20(3,4)18-8-6-5-7-9-18)12-17-13-16-10-11-19(17)15(16)2/h5-12,14-16,19H,13H2,1-4H3/b17-12+/t14-,15-,16-,19-/m1/s1 |
| InChIKey | GDFUJVCLWVUKAY-ZXYNHRKHSA-N |
| XLogP | 4.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.50 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|