C35H45F9N2O4 — CID 10212398
3-[7-[5-hydroxy-2-(4-hydroxyphenyl)-3-methylindol-1-yl]heptyl-(7,7,8,8,9,9,10,10,10-nonafluorodecyl)amino]propane-1,2-diol (PubChem CID 10212398) has the molecular formula C35H45F9N2O4 and a molecular weight of 728.74 g/mol. Its IUPAC name is 3-[7-[5-hydroxy-2-(4-hydroxyphenyl)-3-methylindol-1-yl]heptyl-(7,7,8,8,9,9,10,10,10-nonafluorodecyl)amino]propane-1,2-diol.
| Compound Name | 3-[7-[5-hydroxy-2-(4-hydroxyphenyl)-3-methylindol-1-yl]heptyl-(7,7,8,8,9,9,10,10,10-nonafluorodecyl)amino]propane-1,2-diol |
|---|---|
| PubChem CID | 10212398 |
| Molecular Formula | C35H45F9N2O4 |
| Molecular Weight | 728.74 g/mol |
| Exact Mass | 728.32 |
| IUPAC Name | 3-[7-[5-hydroxy-2-(4-hydroxyphenyl)-3-methylindol-1-yl]heptyl-(7,7,8,8,9,9,10,10,10-nonafluorodecyl)amino]propane-1,2-diol |
| SMILES | Cc1c(-c2ccc(O)cc2)n(CCCCCCCN(CCCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC(O)CO)c2ccc(O)cc12 |
| InChI | InChI=1S/C35H45F9N2O4/c1-24-29-21-27(49)15-16-30(29)46(31(24)25-11-13-26(48)14-12-25)20-10-5-2-4-8-18-45(22-28(50)23-47)19-9-6-3-7-17-32(36,37)33(38,39)34(40,41)35(42,43)44/h11-16,21,28,47-50H,2-10,17-20,22-23H2,1H3 |
| InChIKey | MRMIRLQQICUPPS-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 89.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.74 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|