C19H20O4S2 — CID 102124110
[(1R,4S,5R,6R,12S)-6-phenylsulfanyl-7,13-dioxa-10-thiatetracyclo[6.3.1.11,4.05,12]tridec-2-en-12-yl]methyl acetate (PubChem CID 102124110) has the molecular formula C19H20O4S2 and a molecular weight of 376.50 g/mol. Its IUPAC name is [(1R,4S,5R,6R,12S)-6-phenylsulfanyl-7,13-dioxa-10-thiatetracyclo[6.3.1.11,4.05,12]tridec-2-en-12-yl]methyl acetate.
| Compound Name | [(1R,4S,5R,6R,12S)-6-phenylsulfanyl-7,13-dioxa-10-thiatetracyclo[6.3.1.11,4.05,12]tridec-2-en-12-yl]methyl acetate |
|---|---|
| PubChem CID | 102124110 |
| Molecular Formula | C19H20O4S2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | [(1R,4S,5R,6R,12S)-6-phenylsulfanyl-7,13-dioxa-10-thiatetracyclo[6.3.1.11,4.05,12]tridec-2-en-12-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@]12C3CSC[C@@]14C=C[C@H](O4)[C@@H]2[C@@H](Sc1ccccc1)O3 |
| InChI | InChI=1S/C19H20O4S2/c1-12(20)21-10-19-15-9-24-11-18(19)8-7-14(23-18)16(19)17(22-15)25-13-5-3-2-4-6-13/h2-8,14-17H,9-11H2,1H3/t14-,15?,16+,17+,18-,19-/m0/s1 |
| InChIKey | NAHNDYXAFQZFII-RPBXJUQNSA-N |
| XLogP | 3.12 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|