C12H13F3O2 — CID 102124202
7-(trifluoromethoxy)-2,3,4,5-tetrahydro-1H-naphthalene-4a-carbaldehyde (PubChem CID 102124202) has the molecular formula C12H13F3O2 and a molecular weight of 246.23 g/mol. Its IUPAC name is 7-(trifluoromethoxy)-2,3,4,5-tetrahydro-1H-naphthalene-4a-carbaldehyde.
| Compound Name | 7-(trifluoromethoxy)-2,3,4,5-tetrahydro-1H-naphthalene-4a-carbaldehyde |
|---|---|
| PubChem CID | 102124202 |
| Molecular Formula | C12H13F3O2 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 7-(trifluoromethoxy)-2,3,4,5-tetrahydro-1H-naphthalene-4a-carbaldehyde |
| SMILES | O=CC12CC=C(OC(F)(F)F)C=C1CCCC2 |
| InChI | InChI=1S/C12H13F3O2/c13-12(14,15)17-10-4-6-11(8-16)5-2-1-3-9(11)7-10/h4,7-8H,1-3,5-6H2 |
| InChIKey | BDBSYZYLFUYLRT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|