C31H28N2 — CID 102124708
2-[4-(4-tert-butylphenyl)phenyl]-4,5-diphenyl-1H-imidazole (PubChem CID 102124708) has the molecular formula C31H28N2 and a molecular weight of 428.58 g/mol. Its IUPAC name is 2-[4-(4-tert-butylphenyl)phenyl]-4,5-diphenyl-1H-imidazole.
| Compound Name | 2-[4-(4-tert-butylphenyl)phenyl]-4,5-diphenyl-1H-imidazole |
|---|---|
| PubChem CID | 102124708 |
| Molecular Formula | C31H28N2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | 2-[4-(4-tert-butylphenyl)phenyl]-4,5-diphenyl-1H-imidazole |
| SMILES | CC(C)(C)c1ccc(-c2ccc(-c3nc(-c4ccccc4)c(-c4ccccc4)[nH]3)cc2)cc1 |
| InChI | InChI=1S/C31H28N2/c1-31(2,3)27-20-18-23(19-21-27)22-14-16-26(17-15-22)30-32-28(24-10-6-4-7-11-24)29(33-30)25-12-8-5-9-13-25/h4-21H,1-3H3,(H,32,33) |
| InChIKey | JACWRFWBWWQECN-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|