C23H24N2O5 — CID 102125043
methyl 2-benzyl-7-nitro-1-oxo-3-pentylisoquinoline-4-carboxylate (PubChem CID 102125043) has the molecular formula C23H24N2O5 and a molecular weight of 408.45 g/mol. Its IUPAC name is methyl 2-benzyl-7-nitro-1-oxo-3-pentylisoquinoline-4-carboxylate.
| Compound Name | methyl 2-benzyl-7-nitro-1-oxo-3-pentylisoquinoline-4-carboxylate |
|---|---|
| PubChem CID | 102125043 |
| Molecular Formula | C23H24N2O5 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | methyl 2-benzyl-7-nitro-1-oxo-3-pentylisoquinoline-4-carboxylate |
| SMILES | CCCCCc1c(C(=O)OC)c2ccc([N+](=O)[O-])cc2c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C23H24N2O5/c1-3-4-6-11-20-21(23(27)30-2)18-13-12-17(25(28)29)14-19(18)22(26)24(20)15-16-9-7-5-8-10-16/h5,7-10,12-14H,3-4,6,11,15H2,1-2H3 |
| InChIKey | BNZOKLURZRWINR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 91.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|