C16H24O3 — CID 102125248
2-[(2R,4aS,7R)-7-methoxy-4a,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]prop-2-enoic acid (PubChem CID 102125248) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is 2-[(2R,4aS,7R)-7-methoxy-4a,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]prop-2-enoic acid.
| Compound Name | 2-[(2R,4aS,7R)-7-methoxy-4a,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 102125248 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 2-[(2R,4aS,7R)-7-methoxy-4a,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)[C@@H]1CC[C@@]2(C)CC[C@@H](OC)C(C)=C2C1 |
| InChI | InChI=1S/C16H24O3/c1-10(15(17)18)12-5-7-16(3)8-6-14(19-4)11(2)13(16)9-12/h12,14H,1,5-9H2,2-4H3,(H,17,18)/t12-,14-,16+/m1/s1 |
| InChIKey | LUENTXRJJZAOQE-XPKDYRNWSA-N |
| XLogP | 3.56 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|