C30H29N2O3P — CID 102125443
4-[4-[1-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)cyclohexyl]phenoxy]benzene-1,3-diamine (PubChem CID 102125443) has the molecular formula C30H29N2O3P and a molecular weight of 496.55 g/mol. Its IUPAC name is 4-[4-[1-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)cyclohexyl]phenoxy]benzene-1,3-diamine.
| Compound Name | 4-[4-[1-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)cyclohexyl]phenoxy]benzene-1,3-diamine |
|---|---|
| PubChem CID | 102125443 |
| Molecular Formula | C30H29N2O3P |
| Molecular Weight | 496.55 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 4-[4-[1-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)cyclohexyl]phenoxy]benzene-1,3-diamine |
| SMILES | Nc1ccc(Oc2ccc(C3(P4(=O)Oc5ccccc5-c5ccccc54)CCCCC3)cc2)c(N)c1 |
| InChI | InChI=1S/C30H29N2O3P/c31-22-14-17-28(26(32)20-22)34-23-15-12-21(13-16-23)30(18-6-1-7-19-30)36(33)29-11-5-3-9-25(29)24-8-2-4-10-27(24)35-36/h2-5,8-17,20H,1,6-7,18-19,31-32H2 |
| InChIKey | YFUUTHRVRGXLDD-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.55 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|